CymitQuimica logo

CAS 1269291-12-4

:

1-(2-Nitrophenyl)-5-(trifluoromethyl)-1H-pyrazole

Description:
1-(2-Nitrophenyl)-5-(trifluoromethyl)-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a nitrophenyl group and a trifluoromethyl group. The presence of the nitro group typically imparts significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions. The trifluoromethyl group is known for its electron-withdrawing properties, which can enhance the compound's stability and alter its electronic characteristics. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Additionally, its molecular structure suggests potential applications in agrochemicals or materials science. The compound's solubility, melting point, and other physical properties would depend on its specific interactions with solvents and environmental conditions. Overall, 1-(2-Nitrophenyl)-5-(trifluoromethyl)-1H-pyrazole represents a versatile structure with potential implications in various fields of chemistry and material science.
Formula:C10H6F3N3O2
InChI:InChI=1S/C10H6F3N3O2/c11-10(12,13)9-5-6-14-15(9)7-3-1-2-4-8(7)16(17)18/h1-6H
InChI key:InChIKey=VGGROQRTRZAKBJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(N=CC1)C2=C(N(=O)=O)C=CC=C2
Synonyms:
  • 1-(2-Nitrophenyl)-5-(trifluoromethyl)-1H-pyrazole
  • 1H-Pyrazole, 1-(2-nitrophenyl)-5-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.