CAS 1269291-14-6
:2-[1-(3-Fluorophenyl)-1H-pyrazol-5-yl]thiazole
Description:
2-[1-(3-Fluorophenyl)-1H-pyrazol-5-yl]thiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyrazole moiety substituted with a 3-fluorophenyl group. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. This compound typically exhibits a molecular structure that allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Its thiazole and pyrazole components suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. The compound's properties, such as solubility, stability, and reactivity, can vary based on its specific functional groups and overall molecular geometry. Additionally, the presence of heteroatoms like nitrogen and sulfur in its structure may contribute to its chemical reactivity and potential applications in various chemical reactions or as a ligand in coordination chemistry. Overall, 2-[1-(3-Fluorophenyl)-1H-pyrazol-5-yl]thiazole represents a versatile scaffold for further exploration in drug discovery and development.
Formula:C12H8FN3S
InChI:InChI=1S/C12H8FN3S/c13-9-2-1-3-10(8-9)16-11(4-5-15-16)12-14-6-7-17-12/h1-8H
InChI key:InChIKey=CTVOJDBGYNGAEU-UHFFFAOYSA-N
SMILES:FC=1C=C(N2C(=CC=N2)C3=NC=CS3)C=CC1
Synonyms:- Thiazole, 2-[1-(3-fluorophenyl)-1H-pyrazol-5-yl]-
- 2-[1-(3-Fluorophenyl)-1H-pyrazol-5-yl]thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
