CAS 1269291-16-8
:4-[1-(2-Bromophenyl)-1H-pyrazol-5-yl]pyridine
Description:
4-[1-(2-Bromophenyl)-1H-pyrazol-5-yl]pyridine, with the CAS number 1269291-16-8, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety. The presence of a bromophenyl group enhances its potential for various chemical interactions and applications. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for heterocyclic compounds. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The bromine substituent may influence its reactivity and interactions with biological targets. Additionally, the compound's heteroatoms (nitrogen in the pyrazole and pyridine rings) contribute to its ability to form hydrogen bonds, which can be crucial for its biological activity. Overall, 4-[1-(2-Bromophenyl)-1H-pyrazol-5-yl]pyridine represents a class of compounds that may have significant applications in pharmaceuticals and agrochemicals due to their diverse chemical properties.
Formula:C14H10BrN3
InChI:InChI=1S/C14H10BrN3/c15-12-3-1-2-4-14(12)18-13(7-10-17-18)11-5-8-16-9-6-11/h1-10H
InChI key:InChIKey=HQXXSAJOTWPVDA-UHFFFAOYSA-N
SMILES:BrC1=C(N2C(=CC=N2)C=3C=CN=CC3)C=CC=C1
Synonyms:- Pyridine, 4-[1-(2-bromophenyl)-1H-pyrazol-5-yl]-
- 4-[1-(2-Bromophenyl)-1H-pyrazol-5-yl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
