CAS 1269291-20-4
:3-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]pyridine
Description:
3-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269291-20-4, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety substituted with a fluorophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include anti-inflammatory or anti-cancer effects, although specific biological data would depend on empirical studies. The presence of the fluorine atom can influence the compound's lipophilicity and reactivity, potentially enhancing its pharmacological profile. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or coordination with metal ions. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Overall, 3-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]pyridine represents a class of compounds that are of interest in medicinal chemistry and material science due to their diverse applications.
Formula:C14H10FN3
InChI:InChI=1S/C14H10FN3/c15-12-3-5-13(6-4-12)18-14(7-9-17-18)11-2-1-8-16-10-11/h1-10H
InChI key:InChIKey=WFJAOQCZUKIROW-UHFFFAOYSA-N
SMILES:FC1=CC=C(N2C(=CC=N2)C=3C=CC=NC3)C=C1
Synonyms:- Pyridine, 3-[1-(4-fluorophenyl)-1H-pyrazol-5-yl]-
- 3-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
