
CAS 1269291-21-5
:1-(3-Fluorophenyl)-5-(3-thienyl)-1H-pyrazole
Description:
1-(3-Fluorophenyl)-5-(3-thienyl)-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a 3-fluorophenyl group and a 3-thienyl group. The presence of the fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. The thienyl group, derived from thiophene, contributes to the compound's aromatic character and may impart specific biological activities. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its molecular structure suggests possible interactions with biological targets, making it a candidate for further investigation in pharmacological studies. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the pyrazole ring, which may affect its overall behavior in various chemical environments.
Formula:C13H9FN2S
InChI:InChI=1S/C13H9FN2S/c14-11-2-1-3-12(8-11)16-13(4-6-15-16)10-5-7-17-9-10/h1-9H
InChI key:InChIKey=YVCLJQNJZUHPQM-UHFFFAOYSA-N
SMILES:FC=1C=C(N2C(=CC=N2)C=3C=CSC3)C=CC1
Synonyms:- 1-(3-Fluorophenyl)-5-(3-thienyl)-1H-pyrazole
- 1H-Pyrazole, 1-(3-fluorophenyl)-5-(3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
