
CAS 1269291-22-6
:6-(Bromomethyl)-4(3H)-pyrimidinone
Description:
6-(Bromomethyl)-4(3H)-pyrimidinone is a chemical compound characterized by its pyrimidinone structure, which features a bromomethyl group at the 6-position of the pyrimidine ring. This compound typically exhibits properties associated with heterocyclic organic compounds, including potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The pyrimidinone moiety contributes to its potential biological activity, as many pyrimidine derivatives are known for their roles in pharmaceuticals and agrochemicals. The compound may be soluble in polar organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 6-(Bromomethyl)-4(3H)-pyrimidinone is of interest in synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C5H5BrN2O
InChI:InChI=1S/C5H5BrN2O/c6-2-4-1-5(9)8-3-7-4/h1,3H,2H2,(H,7,8,9)
InChI key:InChIKey=IVXZRMBGDXKOHW-UHFFFAOYSA-N
SMILES:C(Br)C1=CC(=O)N=CN1
Synonyms:- 4(3H)-Pyrimidinone, 6-(bromomethyl)-
- 6-(Bromomethyl)-4(3H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
