
CAS 1269291-29-3
:Pyrimidine, 2-methyl-4-(2-thiazolyl)-
Description:
Pyrimidine, 2-methyl-4-(2-thiazolyl)- is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a methyl group and a thiazole moiety. The pyrimidine ring consists of a six-membered structure containing two nitrogen atoms at positions 1 and 3, which contributes to its basicity and reactivity. The presence of the 2-thiazolyl group introduces additional heteroatoms, enhancing the compound's potential for biological activity and interaction with various biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the specific functional groups and their positions on the ring system. Pyrimidine derivatives are often utilized in pharmaceuticals and agrochemicals due to their diverse biological activities and ability to act as building blocks for more complex molecules. As with many heterocycles, the electronic properties and steric factors play a crucial role in determining the compound's behavior in chemical reactions and interactions.
Formula:C8H7N3S
InChI:InChI=1S/C8H7N3S/c1-6-9-3-2-7(11-6)8-10-4-5-12-8/h2-5H,1H3
InChI key:InChIKey=YRBOLAVORFFCBR-UHFFFAOYSA-N
SMILES:CC=1N=C(C=CN1)C2=NC=CS2
Synonyms:- Pyrimidine, 2-methyl-4-(2-thiazolyl)-
- 2-Methyl-4-(1,3-thiazol-2-yl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
