
CAS 1269291-71-5
:2-[1-(1,1-Dimethylethyl)-1H-pyrazol-5-yl]thiazole
Description:
2-[1-(1,1-Dimethylethyl)-1H-pyrazol-5-yl]thiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyrazole moiety. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents. Its thiazole component is known for its role in various biological activities, including antimicrobial and anti-inflammatory properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis typically involves multi-step organic reactions, which may include cyclization and functional group transformations. Understanding the characteristics of this compound is essential for its application in research and industry, particularly in fields that explore novel chemical entities for therapeutic purposes.
Formula:C10H13N3S
InChI:InChI=1S/C10H13N3S/c1-10(2,3)13-8(4-5-12-13)9-11-6-7-14-9/h4-7H,1-3H3
InChI key:InChIKey=TVDHWTGZBHIPER-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C(=CC=N1)C2=NC=CS2
Synonyms:- Thiazole, 2-[1-(1,1-dimethylethyl)-1H-pyrazol-5-yl]-
- 2-[1-(1,1-Dimethylethyl)-1H-pyrazol-5-yl]thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
