CymitQuimica logo

CAS 1269291-78-2

:

2-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]pyridine

Description:
2-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]pyridine, with the CAS number 1269291-78-2, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety substituted with a fluorophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the fluorine atom in the phenyl ring can influence its electronic properties, potentially enhancing lipophilicity and altering its reactivity. The compound may be of interest in medicinal chemistry due to its structural similarity to known pharmacophores, suggesting possible applications in drug development. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, 2-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]pyridine represents a class of compounds that could be explored for various chemical and biological applications.
Formula:C14H10FN3
InChI:InChI=1S/C14H10FN3/c15-11-5-1-2-7-13(11)18-14(8-10-17-18)12-6-3-4-9-16-12/h1-10H
InChI key:InChIKey=FTGLSZOYJVCFJQ-UHFFFAOYSA-N
SMILES:FC1=C(N2C(=CC=N2)C3=CC=CC=N3)C=CC=C1
Synonyms:
  • Pyridine, 2-[1-(2-fluorophenyl)-1H-pyrazol-5-yl]-
  • 2-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.