CAS 1269291-88-4
:3-[1-(4-Nitrophenyl)-1H-pyrazol-5-yl]pyridine
Description:
3-[1-(4-Nitrophenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269291-88-4, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety substituted with a nitrophenyl group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its aromatic nature. The presence of the nitro group contributes to its electronic properties, potentially enhancing its reactivity and making it useful in various chemical applications, including medicinal chemistry and material science. The compound may exhibit biological activity, which can be attributed to the interactions of its functional groups with biological targets. Its synthesis often involves multi-step organic reactions, and it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be taken when handling it, given the potential toxicity associated with nitro-substituted aromatic compounds.
Formula:C14H10N4O2
InChI:InChI=1S/C14H10N4O2/c19-18(20)13-5-3-12(4-6-13)17-14(7-9-16-17)11-2-1-8-15-10-11/h1-10H
InChI key:InChIKey=NWNRBTLSPABRJQ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(N2C(=CC=N2)C=3C=CC=NC3)C=C1
Synonyms:- 3-[1-(4-Nitrophenyl)-1H-pyrazol-5-yl]pyridine
- Pyridine, 3-[1-(4-nitrophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
