CAS 1269291-91-9
:4-(3-Pyridinyl)-2-(trifluoromethyl)pyrimidine
Description:
4-(3-Pyridinyl)-2-(trifluoromethyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a pyridine ring at the 4-position and a trifluoromethyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. Its trifluoromethyl group enhances lipophilicity and can influence biological activity, making it of interest in medicinal chemistry. The compound may exhibit various reactivity patterns typical of pyrimidines, such as nucleophilic substitution and electrophilic aromatic substitution, depending on the functional groups present. Additionally, it may serve as a building block in the synthesis of pharmaceuticals or agrochemicals, particularly those targeting specific biological pathways. Overall, its structural features suggest potential applications in drug development and materials science.
Formula:C10H6F3N3
InChI:InChI=1S/C10H6F3N3/c11-10(12,13)9-15-5-3-8(16-9)7-2-1-4-14-6-7/h1-6H
InChI key:InChIKey=ROJCVANPLRZNQP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(C=CN1)C=2C=CC=NC2
Synonyms:- 4-(3-Pyridinyl)-2-(trifluoromethyl)pyrimidine
- Pyrimidine, 4-(3-pyridinyl)-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
