
CAS 1269291-97-5
:5-Bromo-1-(3-chlorophenyl)-1H-pyrazole-4-carbonitrile
Description:
5-Bromo-1-(3-chlorophenyl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a chlorophenyl group at the 1-position contributes to its unique reactivity and potential biological activity. The carbonitrile functional group at the 4-position enhances its polarity and can influence its solubility in various solvents. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the field of anti-inflammatory and anti-cancer agents. Its structural features suggest that it may interact with biological targets through mechanisms such as enzyme inhibition or receptor modulation. Additionally, the presence of halogen substituents can enhance lipophilicity and bioavailability. As with many pyrazole derivatives, it may exhibit a range of pharmacological properties, making it a subject of research in various scientific studies.
Formula:C10H5BrClN3
InChI:InChI=1S/C10H5BrClN3/c11-10-7(5-13)6-14-15(10)9-3-1-2-8(12)4-9/h1-4,6H
InChI key:InChIKey=QRLYSVJCOHITPL-UHFFFAOYSA-N
SMILES:BrC=1N(N=CC1C#N)C2=CC(Cl)=CC=C2
Synonyms:- 1H-Pyrazole-4-carbonitrile, 5-bromo-1-(3-chlorophenyl)-
- 5-Bromo-1-(3-chlorophenyl)-1H-pyrazole-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.