
CAS 1269292-08-1
:1-(2-Fluorophenyl)-1H-pyrazole-5-carboxaldehyde
Description:
1-(2-Fluorophenyl)-1H-pyrazole-5-carboxaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and reactivity. The carboxaldehyde functional group (-CHO) at the 5-position of the pyrazole ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability, which are important factors in pharmacology. Overall, 1-(2-Fluorophenyl)-1H-pyrazole-5-carboxaldehyde is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C10H7FN2O
InChI:InChI=1S/C10H7FN2O/c11-9-3-1-2-4-10(9)13-8(7-14)5-6-12-13/h1-7H
InChI key:InChIKey=ZYVKIULIVOUCKQ-UHFFFAOYSA-N
SMILES:C(=O)C=1N(N=CC1)C2=C(F)C=CC=C2
Synonyms:- 1H-Pyrazole-5-carboxaldehyde, 1-(2-fluorophenyl)-
- 1-(2-Fluorophenyl)-1H-pyrazole-5-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
