CymitQuimica logo

CAS 1269292-09-2

:

1-(2-Nitrophenyl)-1H-pyrazole-5-carboxaldehyde

Description:
1-(2-Nitrophenyl)-1H-pyrazole-5-carboxaldehyde is an organic compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a nitrophenyl group indicates that a nitro group is attached to a phenyl ring, contributing to the compound's potential reactivity and polarity. The carboxaldehyde functional group (-CHO) at the 5-position of the pyrazole ring suggests that this compound can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as solubility and stability, can be influenced by the substituents on the pyrazole and phenyl rings. Additionally, the nitro group can enhance the compound's electron-withdrawing characteristics, potentially affecting its reactivity and interactions with biological targets. Overall, 1-(2-Nitrophenyl)-1H-pyrazole-5-carboxaldehyde is a versatile compound with applications in research and development.
Formula:C10H7N3O3
InChI:InChI=1S/C10H7N3O3/c14-7-8-5-6-11-12(8)9-3-1-2-4-10(9)13(15)16/h1-7H
InChI key:InChIKey=KOXGCYXEIVBUBY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC=C1)N2C(C=O)=CC=N2
Synonyms:
  • 1-(2-Nitrophenyl)-1H-pyrazole-5-carboxaldehyde
  • 1H-Pyrazole-5-carboxaldehyde, 1-(2-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.