CAS 1269292-16-1
:2-[1-(4-Nitrophenyl)-1H-pyrazol-5-yl]pyridine
Description:
2-[1-(4-Nitrophenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269292-16-1, is an organic compound characterized by its complex structure, which includes a pyridine ring and a pyrazole moiety substituted with a nitrophenyl group. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its electronic properties and reactivity. It is likely to be soluble in organic solvents, reflecting the hydrophobic nature of its aromatic components. The presence of the nitro group may impart significant polar character, affecting its interactions in various chemical environments. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and ability to form coordination complexes. Additionally, its unique structure may allow for specific interactions with biological targets, making it a candidate for further research in drug development or as a chemical probe. Safety and handling precautions should be observed due to the potential toxicity associated with nitroaromatic compounds.
Formula:C14H10N4O2
InChI:InChI=1S/C14H10N4O2/c19-18(20)12-6-4-11(5-7-12)17-14(8-10-16-17)13-3-1-2-9-15-13/h1-10H
InChI key:InChIKey=JNEUEKRMMAVGKJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(N2C(=CC=N2)C3=CC=CC=N3)C=C1
Synonyms:- 2-[1-(4-Nitrophenyl)-1H-pyrazol-5-yl]pyridine
- Pyridine, 2-[1-(4-nitrophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
