CAS 1269292-17-2
:4-[1-(2-Chlorophenyl)-1H-pyrazol-5-yl]pyridine
Description:
4-[1-(2-Chlorophenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269292-17-2, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety. The presence of a 2-chlorophenyl group enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound typically exhibits moderate to high lipophilicity due to its aromatic components, which can influence its solubility and permeability in biological systems. Its molecular structure suggests potential interactions with various biological targets, possibly leading to applications in pharmaceuticals. The compound may also display specific reactivity patterns typical of heterocyclic compounds, such as electrophilic substitution or coordination with metal ions. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, 4-[1-(2-Chlorophenyl)-1H-pyrazol-5-yl]pyridine represents a class of compounds that could be explored for therapeutic applications, particularly in the fields of oncology or inflammation.
Formula:C14H10ClN3
InChI:InChI=1S/C14H10ClN3/c15-12-3-1-2-4-14(12)18-13(7-10-17-18)11-5-8-16-9-6-11/h1-10H
InChI key:InChIKey=LXQBUZNRVUPKMG-UHFFFAOYSA-N
SMILES:ClC1=C(N2C(=CC=N2)C=3C=CN=CC3)C=CC=C1
Synonyms:- 4-[1-(2-Chlorophenyl)-1H-pyrazol-5-yl]pyridine
- Pyridine, 4-[1-(2-chlorophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
