CAS 1269292-18-3
:1-(2-Nitrophenyl)-5-phenyl-1H-pyrazole
Description:
1-(2-Nitrophenyl)-5-phenyl-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a nitrophenyl group at the 1-position and a phenyl group at the 5-position of the pyrazole ring, contributing to its potential reactivity and biological activity. The presence of the nitro group typically enhances the compound's electron-withdrawing properties, which can influence its chemical behavior and interactions. This compound may exhibit various properties such as solubility in organic solvents, depending on its specific structure and substituents. It is often studied for its potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The CAS number 1269292-18-3 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. As with many pyrazole derivatives, it may possess interesting pharmacological properties, making it a subject of research in medicinal chemistry.
Formula:C15H11N3O2
InChI:InChI=1S/C15H11N3O2/c19-18(20)15-9-5-4-8-14(15)17-13(10-11-16-17)12-6-2-1-3-7-12/h1-11H
InChI key:InChIKey=PKXNSITUBXLXMS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N2C(=CC=N2)C3=CC=CC=C3)C=CC=C1
Synonyms:- 1-(2-Nitrophenyl)-5-phenyl-1H-pyrazole
- 1H-Pyrazole, 1-(2-nitrophenyl)-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
