CAS 1269292-35-4
:2-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]thiazole
Description:
2-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]thiazole is an organic compound characterized by its unique structural features, which include a thiazole ring and a pyrazole moiety substituted with a bromophenyl group. The presence of the bromine atom enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The thiazole ring contributes to the compound's heterocyclic nature, which is often associated with various pharmacological properties. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. Its molecular structure allows for potential interactions with biological targets, making it a candidate for drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the rings, which are critical for its application in various chemical and pharmaceutical contexts. Overall, 2-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]thiazole represents a class of compounds that are valuable in research and development within the field of organic chemistry and drug discovery.
Formula:C12H8BrN3S
InChI:InChI=1S/C12H8BrN3S/c13-9-1-3-10(4-2-9)16-11(5-6-15-16)12-14-7-8-17-12/h1-8H
InChI key:InChIKey=BSSDJVWXULJZFJ-UHFFFAOYSA-N
SMILES:BrC1=CC=C(N2C(=CC=N2)C3=NC=CS3)C=C1
Synonyms:- Thiazole, 2-[1-(4-bromophenyl)-1H-pyrazol-5-yl]-
- 2-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
