
CAS 1269292-37-6
:2-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyrimidine
Description:
2-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyrimidine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a pyrazole moiety. The presence of the 4-methylphenyl group enhances its aromatic character and may influence its solubility and reactivity. This compound is typically classified as an organic heterocyclic compound due to the incorporation of nitrogen atoms in its rings. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, which could lead to applications in pharmaceuticals. Additionally, its properties such as melting point, boiling point, and solubility would depend on the specific conditions and solvents used. As with many organic compounds, the stability and reactivity can be influenced by substituents on the aromatic rings. Overall, 2-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyrimidine represents a class of compounds that may have significant implications in various chemical and biological contexts.
Formula:C14H12N4
InChI:InChI=1S/C14H12N4/c1-11-3-5-12(6-4-11)18-13(7-10-17-18)14-15-8-2-9-16-14/h2-10H,1H3
InChI key:InChIKey=ZRJFPIVGFBQQTL-UHFFFAOYSA-N
SMILES:CC1=CC=C(N2C(=CC=N2)C=3N=CC=CN3)C=C1
Synonyms:- Pyrimidine, 2-[1-(4-methylphenyl)-1H-pyrazol-5-yl]-
- 2-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
