CymitQuimica logo

CAS 1269292-40-1

:

Pyrrolidine, 2-(2-hydrazinylethyl)-1-methyl-, hydrochloride (1:1)

Description:
Pyrrolidine, 2-(2-hydrazinylethyl)-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The compound features a hydrazine moiety, indicating the presence of a hydrazine functional group (-NH-NH2), which is known for its reactivity and potential applications in various chemical reactions, including as a reducing agent. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for storage and handling. This compound may exhibit biological activity, potentially influencing its use in pharmaceutical applications or as a research chemical. Its molecular structure contributes to its properties, including its polarity and ability to interact with biological systems. As with many nitrogen-containing compounds, it may also exhibit unique reactivity patterns, making it of interest in synthetic organic chemistry and medicinal chemistry. Safety and handling precautions should be observed due to the presence of hydrazine, which can be toxic and hazardous.
Formula:C7H17N3·ClH
InChI:InChI=1S/C7H17N3.ClH/c1-10-6-2-3-7(10)4-5-9-8;/h7,9H,2-6,8H2,1H3;1H
InChI key:InChIKey=FINSQCLIXAZYAO-UHFFFAOYSA-N
SMILES:C(CNN)C1N(C)CCC1.Cl
Synonyms:
  • Pyrrolidine, 2-(2-hydrazinylethyl)-1-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.