CAS 1269292-43-4
:3-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]pyridine
Description:
3-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pyrazole moiety substituted with a bromophenyl group. The presence of the bromine atom on the phenyl ring enhances its reactivity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds with specific pharmacological activities. The compound's CAS number, 1269292-43-4, allows for precise identification and retrieval of information in chemical databases. Overall, the characteristics of this compound, including its functional groups and structural features, contribute to its potential utility in various chemical and pharmaceutical applications.
Formula:C14H10BrN3
InChI:InChI=1S/C14H10BrN3/c15-12-3-5-13(6-4-12)18-14(7-9-17-18)11-2-1-8-16-10-11/h1-10H
InChI key:InChIKey=VSEBVMDZLMQVTO-UHFFFAOYSA-N
SMILES:BrC1=CC=C(N2C(=CC=N2)C=3C=CC=NC3)C=C1
Synonyms:- Pyridine, 3-[1-(4-bromophenyl)-1H-pyrazol-5-yl]-
- 3-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
