
CAS 1269292-85-4
:1-(3-Chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole
Description:
1-(3-Chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 3-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the meta position, contributing to the compound's unique electronic and steric properties. Additionally, the trifluoromethyl group (-CF3) at the 5-position of the pyrazole ring enhances its lipophilicity and can influence its biological activity. This compound is often studied for its potential applications in pharmaceuticals and agrochemicals due to its ability to interact with various biological targets. Its molecular structure suggests that it may exhibit interesting reactivity and stability under certain conditions. The presence of halogen substituents typically affects the compound's solubility, melting point, and overall reactivity, making it a subject of interest in synthetic chemistry and material science.
Formula:C10H6ClF3N2
InChI:InChI=1S/C10H6ClF3N2/c11-7-2-1-3-8(6-7)16-9(4-5-15-16)10(12,13)14/h1-6H
InChI key:InChIKey=BAWHNJQMQYMYHW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(N=CC1)C2=CC(Cl)=CC=C2
Synonyms:- 1-(3-Chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole
- 1H-Pyrazole, 1-(3-chlorophenyl)-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
