CAS 1269292-87-6
:1-Methyl-5-(3-thienyl)-1H-pyrazole
Description:
1-Methyl-5-(3-thienyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a methyl group at the 1-position and a thienyl group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its thienyl substituent introduces aromatic characteristics, which can influence its reactivity and interactions with other molecules. 1-Methyl-5-(3-thienyl)-1H-pyrazole may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to form coordination complexes. Additionally, the compound's structure allows for various functionalization possibilities, making it a versatile building block in synthetic chemistry. As with many pyrazole derivatives, it may exhibit interesting pharmacological properties, warranting further investigation for potential applications in drug development.
Formula:C8H8N2S
InChI:InChI=1S/C8H8N2S/c1-10-8(2-4-9-10)7-3-5-11-6-7/h2-6H,1H3
InChI key:InChIKey=XRWDQVRBGPLPSQ-UHFFFAOYSA-N
SMILES:CN1C(=CC=N1)C=2C=CSC2
Synonyms:- 1-Methyl-5-(3-thienyl)-1H-pyrazole
- 1-Methyl-5-(thiophen-3-yl)-1H-pyrazole
- 1H-Pyrazole, 1-methyl-5-(3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
