CAS 1269293-00-6
:4-[1-(2-Nitrophenyl)-1H-pyrazol-5-yl]pyridine
Description:
4-[1-(2-Nitrophenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269293-00-6, is an organic compound characterized by its complex molecular structure, which includes a pyridine ring and a pyrazole moiety substituted with a nitrophenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both nitrogen-containing heterocycles and a nitro group, which can participate in various chemical reactions. The presence of the nitro group may impart additional polar characteristics, influencing its interactions in biological systems or chemical environments. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications or experimental settings.
Formula:C14H10N4O2
InChI:InChI=1S/C14H10N4O2/c19-18(20)14-4-2-1-3-13(14)17-12(7-10-16-17)11-5-8-15-9-6-11/h1-10H
InChI key:InChIKey=RKLMYJWCLYRIEN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N2C(=CC=N2)C=3C=CN=CC3)C=CC=C1
Synonyms:- 4-[1-(2-Nitrophenyl)-1H-pyrazol-5-yl]pyridine
- Pyridine, 4-[1-(2-nitrophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
