CAS 1269293-01-7
:5-Fluoro-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile
Description:
5-Fluoro-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a fluorine atom at the 5-position and a 4-methylphenyl group at the 1-position contributes to its unique chemical properties and potential biological activity. The carbonitrile functional group at the 4-position enhances its reactivity and may influence its solubility and polarity. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its structure suggests potential applications in medicinal chemistry, where modifications can lead to compounds with desired pharmacological effects. The compound's stability, reactivity, and interaction with biological targets are of interest in various fields, including agrochemicals and drug discovery. As with many pyrazole derivatives, it may exhibit diverse biological activities, making it a subject of investigation in the search for new therapeutic agents.
Formula:C11H8FN3
InChI:InChI=1S/C11H8FN3/c1-8-2-4-10(5-3-8)15-11(12)9(6-13)7-14-15/h2-5,7H,1H3
InChI key:InChIKey=RFCYPBNEZMIXAK-UHFFFAOYSA-N
SMILES:FC=1N(N=CC1C#N)C2=CC=C(C)C=C2
Synonyms:- 5-Fluoro-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile
- 1H-Pyrazole-4-carbonitrile, 5-fluoro-1-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
