CAS 1269293-02-8
:3-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]pyridine
Description:
3-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269293-02-8, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety. The presence of a fluorophenyl group enhances its potential for biological activity and may influence its electronic properties. This compound is typically classified as an organic heterocyclic compound due to the incorporation of nitrogen atoms in its rings. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit significant biological activities, including anti-inflammatory and anti-cancer properties. The fluorine atom can also enhance lipophilicity and metabolic stability, making it a valuable feature in drug design. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which are critical for its interaction with biological targets. Overall, 3-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]pyridine represents a class of compounds with promising applications in various fields of chemistry and pharmacology.
Formula:C14H10FN3
InChI:InChI=1S/C14H10FN3/c15-12-5-1-2-6-14(12)18-13(7-9-17-18)11-4-3-8-16-10-11/h1-10H
InChI key:InChIKey=OWWFXHSXKWXRBL-UHFFFAOYSA-N
SMILES:FC1=C(N2C(=CC=N2)C=3C=CC=NC3)C=CC=C1
Synonyms:- 3-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]pyridine
- Pyridine, 3-[1-(2-fluorophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
