CAS 1269293-05-1
:3-[1-(3-Fluorophenyl)-1H-pyrazol-5-yl]pyridine
Description:
3-[1-(3-Fluorophenyl)-1H-pyrazol-5-yl]pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pyrazole moiety substituted with a 3-fluorophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the fluorine atom can influence its electronic properties, potentially enhancing lipophilicity and altering its reactivity. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as many pyrazole and pyridine derivatives have been explored for their pharmacological properties. Additionally, the specific arrangement of functional groups can affect its interaction with biological targets, making it a candidate for further investigation in various therapeutic areas. As with many synthetic organic compounds, its stability, reactivity, and interactions with other substances would depend on the specific conditions under which it is studied.
Formula:C14H10FN3
InChI:InChI=1S/C14H10FN3/c15-12-4-1-5-13(9-12)18-14(6-8-17-18)11-3-2-7-16-10-11/h1-10H
InChI key:InChIKey=CMVZNBUYCQXNPQ-UHFFFAOYSA-N
SMILES:FC=1C=C(N2C(=CC=N2)C=3C=CC=NC3)C=CC1
Synonyms:- 3-[1-(3-Fluorophenyl)-1H-pyrazol-5-yl]pyridine
- Pyridine, 3-[1-(3-fluorophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
