CymitQuimica logo

CAS 1269293-09-5

:

5-Bromo-2-fluoro-6-methyl-3-pyridinamine

Description:
5-Bromo-2-fluoro-6-methyl-3-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of bromine and fluorine substituents at the 5 and 2 positions, respectively, along with a methyl group at the 6 position, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative halogen atoms, which can influence its solubility in various solvents. The amino group at the 3 position enhances its reactivity, making it a potential candidate for further chemical modifications or as an intermediate in synthetic pathways. Additionally, the presence of multiple functional groups suggests that it may participate in hydrogen bonding and other intermolecular interactions. Its specific applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and reactivity. Overall, 5-Bromo-2-fluoro-6-methyl-3-pyridinamine is a versatile compound with potential utility in various chemical and medicinal contexts.
Formula:C6H6BrFN2
InChI:InChI=1S/C6H6BrFN2/c1-3-4(7)2-5(9)6(8)10-3/h2H,9H2,1H3
InChI key:InChIKey=PORYRZMDGCDNRW-UHFFFAOYSA-N
SMILES:BrC1=C(C)N=C(F)C(N)=C1
Synonyms:
  • 5-Bromo-2-fluoro-6-methyl-3-pyridinamine
  • 3-Pyridinamine, 5-bromo-2-fluoro-6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.