CAS 1269293-15-3
:2-[5-(Dimethoxymethyl)-1H-pyrazol-1-yl]pyridine
Description:
2-[5-(Dimethoxymethyl)-1H-pyrazol-1-yl]pyridine, with the CAS number 1269293-15-3, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety. The presence of dimethoxymethyl groups contributes to its solubility and reactivity, making it of interest in various chemical applications. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential interactions with biological systems, which could be explored for pharmaceutical applications. The compound's functional groups may also impart specific properties such as polarity and hydrogen bonding capabilities, influencing its behavior in different solvents. Additionally, the presence of nitrogen atoms in both the pyridine and pyrazole rings can enhance its coordination chemistry, making it a candidate for studies in metal complexation. Overall, 2-[5-(Dimethoxymethyl)-1H-pyrazol-1-yl]pyridine is a versatile compound with potential utility in medicinal chemistry and materials science.
Formula:C11H13N3O2
InChI:InChI=1S/C11H13N3O2/c1-15-11(16-2)9-6-8-13-14(9)10-5-3-4-7-12-10/h3-8,11H,1-2H3
InChI key:InChIKey=JNDWUMRXFAUHEO-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1N(N=CC1)C2=CC=CC=N2
Synonyms:- Pyridine, 2-[5-(dimethoxymethyl)-1H-pyrazol-1-yl]-
- 2-[5-(Dimethoxymethyl)-1H-pyrazol-1-yl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
