CAS 1269293-17-5
:1-(2-Nitrophenyl)-5-(2-thienyl)-1H-pyrazole
Description:
1-(2-Nitrophenyl)-5-(2-thienyl)-1H-pyrazole is an organic compound characterized by its unique structural features, which include a pyrazole ring substituted with a nitrophenyl group and a thienyl group. The presence of the nitro group introduces significant polarity and potential for hydrogen bonding, which can influence the compound's reactivity and solubility. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic character and may enhance its electronic properties. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in the synthesis of more complex molecules. Its molecular structure suggests possible applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of study in both synthetic and applied chemistry contexts. Overall, 1-(2-Nitrophenyl)-5-(2-thienyl)-1H-pyrazole exemplifies the complexity and versatility of organic compounds in chemical research.
Formula:C13H9N3O2S
InChI:InChI=1S/C13H9N3O2S/c17-16(18)11-5-2-1-4-10(11)15-12(7-8-14-15)13-6-3-9-19-13/h1-9H
InChI key:InChIKey=NCRGXUDFYSKLRA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N2C(=CC=N2)C3=CC=CS3)C=CC=C1
Synonyms:- 1-(2-Nitrophenyl)-5-(2-thienyl)-1H-pyrazole
- 1H-Pyrazole, 1-(2-nitrophenyl)-5-(2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
