CAS 1269293-29-9
:1-(1,1-Dimethylethyl)-3-phenyl-1H-pyrazole
Description:
1-(1,1-Dimethylethyl)-3-phenyl-1H-pyrazole, identified by its CAS number 1269293-29-9, is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a tert-butyl group and a phenyl group. This compound typically exhibits properties associated with pyrazoles, such as potential biological activity, making it of interest in pharmaceutical and agricultural research. The presence of the tert-butyl group contributes to its hydrophobic characteristics, while the phenyl group can enhance its interactions with various biological targets. The compound may also display stability under standard conditions, although specific reactivity can depend on the functional groups present. Its synthesis often involves multi-step organic reactions, and it may be evaluated for its efficacy in various applications, including as a potential agrochemical or pharmaceutical agent. As with many organic compounds, safety data and handling precautions are essential for laboratory work involving this substance.
Formula:C13H16N2
InChI:InChI=1S/C13H16N2/c1-13(2,3)15-10-9-12(14-15)11-7-5-4-6-8-11/h4-10H,1-3H3
InChI key:InChIKey=UECGAZMPLYGHSC-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1N=C(C=C1)C2=CC=CC=C2
Synonyms:- 1H-Pyrazole, 1-(1,1-dimethylethyl)-3-phenyl-
- 1-(1,1-Dimethylethyl)-3-phenyl-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
