CymitQuimica logo

CAS 1269293-40-4

:

9-Bromo-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one

Description:
9-Bromo-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a seven-membered nitrogen-containing ring. The presence of a bromine atom at the 9-position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms incorporated into its structure, which affects its physical properties and stability. The carbonyl group (ketone) at the 2-position plays a significant role in its chemical behavior, influencing its reactivity and interactions with other molecules. As a member of the benzazepine family, it may exhibit biological activity, making it of interest for pharmaceutical research. Its specific properties, such as solubility, melting point, and spectral characteristics, would depend on the molecular interactions and the environment in which it is studied. Overall, 9-Bromo-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one represents a complex structure with potential implications in various chemical and biological applications.
Formula:C10H10BrNO
InChI:InChI=1S/C10H10BrNO/c11-8-5-1-3-7-4-2-6-9(13)12-10(7)8/h1,3,5H,2,4,6H2,(H,12,13)
InChI key:InChIKey=XJCNUZDRXQVXDS-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC=C1)CCCC(=O)N2
Synonyms:
  • 9-Bromo-1,3,4,5-tetrahydro-2H-1-benzazepin-2-one
  • 2H-1-Benzazepin-2-one, 9-bromo-1,3,4,5-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.