CymitQuimica logo

CAS 1269293-49-3

:

Ethyl 5-chloro-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate

Description:
Ethyl 5-chloro-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro substituent at the 5-position and a 4-fluorophenyl group at the 1-position, contributing to its unique chemical properties and potential biological activity. The ethyl ester functional group at the 3-position enhances its solubility and reactivity, making it of interest in medicinal chemistry. The presence of halogen atoms, such as chlorine and fluorine, often influences the compound's lipophilicity and can affect its interaction with biological targets. Ethyl 5-chloro-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate may exhibit various pharmacological activities, which can be explored in drug development. Its molecular structure suggests potential applications in fields such as agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. As with any chemical substance, safety and handling precautions should be observed due to its potential biological effects.
Formula:C12H10ClFN2O2
InChI:InChI=1S/C12H10ClFN2O2/c1-2-18-12(17)10-7-11(13)16(15-10)9-5-3-8(14)4-6-9/h3-7H,2H2,1H3
InChI key:InChIKey=MLTLSZIMBBUFBP-UHFFFAOYSA-N
SMILES:ClC=1N(N=C(C(OCC)=O)C1)C2=CC=C(F)C=C2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 5-chloro-1-(4-fluorophenyl)-, ethyl ester
  • Ethyl 5-chloro-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.