
CAS 1269293-55-1
:2-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]thiazole
Description:
2-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]thiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyrazole moiety substituted with a 4-fluorophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the thiazole ring contributes to the compound's electronic properties, potentially affecting its reactivity and stability. The compound may be synthesized through various organic reactions, and its derivatives could exhibit a range of pharmacological activities, including anti-inflammatory or antimicrobial effects. As with many heterocycles, the solubility and stability in different solvents can vary, which is crucial for its application in drug formulation. Overall, 2-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]thiazole represents a class of compounds that are valuable in the development of new therapeutic agents.
Formula:C12H8FN3S
InChI:InChI=1S/C12H8FN3S/c13-9-1-3-10(4-2-9)16-11(5-6-15-16)12-14-7-8-17-12/h1-8H
InChI key:InChIKey=ZMRHBQKIEULOKT-UHFFFAOYSA-N
SMILES:FC1=CC=C(N2C(=CC=N2)C3=NC=CS3)C=C1
Synonyms:- 2-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]thiazole
- Thiazole, 2-[1-(4-fluorophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
