CAS 1269293-57-3
:2-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]pyridine
Description:
2-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]pyridine is an organic compound characterized by its complex structure, which includes a pyridine ring and a pyrazole moiety substituted with a bromophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the bromine atom enhances its reactivity and may influence its interaction with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit specific electronic properties due to the conjugation between the aromatic rings and the heteroatoms. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 2-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]pyridine is a notable compound for research in fields such as pharmaceuticals and materials science, where its unique characteristics can be leveraged for various applications.
Formula:C14H10BrN3
InChI:InChI=1S/C14H10BrN3/c15-11-4-6-12(7-5-11)18-14(8-10-17-18)13-3-1-2-9-16-13/h1-10H
InChI key:InChIKey=RZADPWSERVBQSR-UHFFFAOYSA-N
SMILES:BrC1=CC=C(N2C(=CC=N2)C3=CC=CC=N3)C=C1
Synonyms:- 2-[1-(4-Bromophenyl)-1H-pyrazol-5-yl]pyridine
- Pyridine, 2-[1-(4-bromophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
