CAS 1269293-88-0
:2-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]thiazole
Description:
2-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]thiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyrazole moiety substituted with a fluorophenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. The thiazole ring contributes to the compound's stability and reactivity, often participating in various chemical reactions. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, and its molecular interactions can be influenced by the presence of functional groups. Overall, 2-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]thiazole is a compound that may have applications in drug development and research, particularly in the fields of pharmacology and biochemistry.
Formula:C12H8FN3S
InChI:InChI=1S/C12H8FN3S/c13-9-3-1-2-4-10(9)16-11(5-6-15-16)12-14-7-8-17-12/h1-8H
InChI key:InChIKey=ZGYBGSRCKABENI-UHFFFAOYSA-N
SMILES:FC1=C(N2C(=CC=N2)C3=NC=CS3)C=CC=C1
Synonyms:- Thiazole, 2-[1-(2-fluorophenyl)-1H-pyrazol-5-yl]-
- 2-[1-(2-Fluorophenyl)-1H-pyrazol-5-yl]thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
