CAS 1269293-91-5
:2-[1-(2-Bromophenyl)-1H-pyrazol-5-yl]pyridine
Description:
2-[1-(2-Bromophenyl)-1H-pyrazol-5-yl]pyridine is an organic compound characterized by its complex structure, which includes a pyridine ring and a pyrazole moiety substituted with a bromophenyl group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the bromine atom can enhance its reactivity and influence its solubility in organic solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures have been associated with various biological activities. Safety and handling precautions should be observed, as with many brominated organic compounds, due to potential toxicity and environmental concerns. Overall, 2-[1-(2-Bromophenyl)-1H-pyrazol-5-yl]pyridine represents a valuable structure for further research in chemical and biological fields.
Formula:C14H10BrN3
InChI:InChI=1S/C14H10BrN3/c15-11-5-1-2-7-13(11)18-14(8-10-17-18)12-6-3-4-9-16-12/h1-10H
InChI key:InChIKey=WXPPJMCFEDRFPM-UHFFFAOYSA-N
SMILES:BrC1=C(N2C(=CC=N2)C3=CC=CC=N3)C=CC=C1
Synonyms:- Pyridine, 2-[1-(2-bromophenyl)-1H-pyrazol-5-yl]-
- 2-[1-(2-Bromophenyl)-1H-pyrazol-5-yl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
