CymitQuimica logo

CAS 1269293-93-7

:

2-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyridine

Description:
2-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269293-93-7, is an organic compound characterized by its complex structure, which includes a pyridine ring and a pyrazole moiety. This compound features a 4-methylphenyl group attached to the pyrazole, contributing to its aromatic properties and potential hydrophobic interactions. The presence of both nitrogen-containing rings (pyridine and pyrazole) suggests that it may exhibit interesting coordination chemistry and biological activity, potentially acting as a ligand in metal complexes or as a pharmacophore in medicinal chemistry. Its molecular structure may impart specific electronic properties, influencing its reactivity and interactions with other molecules. Additionally, the compound's solubility, stability, and melting point can vary based on environmental conditions and the presence of solvents. Overall, 2-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyridine is of interest in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its unique structural features and potential applications.
Formula:C15H13N3
InChI:InChI=1S/C15H13N3/c1-12-5-7-13(8-6-12)18-15(9-11-17-18)14-4-2-3-10-16-14/h2-11H,1H3
InChI key:InChIKey=BSQFYSFLMBWURA-UHFFFAOYSA-N
SMILES:CC1=CC=C(N2C(=CC=N2)C3=CC=CC=N3)C=C1
Synonyms:
  • 2-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyridine
  • Pyridine, 2-[1-(4-methylphenyl)-1H-pyrazol-5-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.