
CAS 1269293-95-9
:3-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyridine
Description:
3-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269293-95-9, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety. The presence of a 4-methylphenyl group enhances its aromatic character and may influence its solubility and reactivity. This compound is typically categorized as an organic heterocyclic compound due to the inclusion of nitrogen atoms in its rings. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. The presence of multiple functional groups may also allow for diverse chemical reactivity, making it a candidate for further synthetic modifications. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other chemical entities. Overall, 3-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyridine represents a versatile structure with potential implications in various fields of chemistry and drug development.
Formula:C15H13N3
InChI:InChI=1S/C15H13N3/c1-12-4-6-14(7-5-12)18-15(8-10-17-18)13-3-2-9-16-11-13/h2-11H,1H3
InChI key:InChIKey=WSNVPXJRJNDVBZ-UHFFFAOYSA-N
SMILES:CC1=CC=C(N2C(=CC=N2)C=3C=CC=NC3)C=C1
Synonyms:- 3-[1-(4-Methylphenyl)-1H-pyrazol-5-yl]pyridine
- Pyridine, 3-[1-(4-methylphenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
