CAS 1269293-96-0
:4-(2-Pyridinyl)-2-(trifluoromethyl)pyrimidine
Description:
4-(2-Pyridinyl)-2-(trifluoromethyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a pyridine ring at position 4 and a trifluoromethyl group at position 2 contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. Its trifluoromethyl group enhances lipophilicity and can influence biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit various functional properties, including potential antimicrobial or antitumor activities, due to the presence of the nitrogen-containing heterocycles. Additionally, its structure allows for potential interactions with biological targets, making it a candidate for further research in pharmacology. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with fluorinated groups, which can pose environmental and health risks.
Formula:C10H6F3N3
InChI:InChI=1S/C10H6F3N3/c11-10(12,13)9-15-6-4-8(16-9)7-3-1-2-5-14-7/h1-6H
InChI key:InChIKey=DIJAHKFMKFBHKM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(C=CN1)C2=CC=CC=N2
Synonyms:- 4-(2-Pyridinyl)-2-(trifluoromethyl)pyrimidine
- Pyrimidine, 4-(2-pyridinyl)-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
