CAS 1269294-01-0
:2-[1-(2-Chlorophenyl)-1H-pyrazol-5-yl]thiazole
Description:
2-[1-(2-Chlorophenyl)-1H-pyrazol-5-yl]thiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyrazole moiety substituted with a 2-chlorophenyl group. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmacologically active compounds. The chlorophenyl substitution can influence the compound's lipophilicity and reactivity, potentially enhancing its interaction with biological targets. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, due to the presence of electron-withdrawing and electron-donating groups. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 2-[1-(2-Chlorophenyl)-1H-pyrazol-5-yl]thiazole represents a class of compounds with potential applications in medicinal chemistry and drug development.
Formula:C12H8ClN3S
InChI:InChI=1S/C12H8ClN3S/c13-9-3-1-2-4-10(9)16-11(5-6-15-16)12-14-7-8-17-12/h1-8H
InChI key:InChIKey=CLXAMPGWYYSROR-UHFFFAOYSA-N
SMILES:ClC1=C(N2C(=CC=N2)C3=NC=CS3)C=CC=C1
Synonyms:- 2-[1-(2-Chlorophenyl)-1H-pyrazol-5-yl]thiazole
- Thiazole, 2-[1-(2-chlorophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
