CAS 1269294-03-2
:2-(1-Methyl-1H-pyrazol-5-yl)pyrimidine
Description:
2-(1-Methyl-1H-pyrazol-5-yl)pyrimidine is a heterocyclic organic compound characterized by the presence of both a pyrimidine and a pyrazole ring in its structure. This compound features a methyl group attached to the pyrazole nitrogen, which can influence its reactivity and solubility. It typically exhibits moderate polarity due to the presence of nitrogen atoms in both rings, which can participate in hydrogen bonding. The compound may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with various biological targets, and it may be synthesized through various organic reactions involving pyrimidine and pyrazole derivatives. The compound's stability, solubility, and reactivity can vary based on the specific conditions and solvents used in its handling and application. As with many heterocycles, it may also exhibit unique spectroscopic properties, making it identifiable through techniques such as NMR and mass spectrometry.
Formula:C8H8N4
InChI:InChI=1S/C8H8N4/c1-12-7(3-6-11-12)8-9-4-2-5-10-8/h2-6H,1H3
InChI key:InChIKey=NVQKDLSXBFWQNB-UHFFFAOYSA-N
SMILES:CN1C(=CC=N1)C=2N=CC=CN2
Synonyms:- 2-(1-Methyl-1H-pyrazol-5-yl)pyrimidine
- Pyrimidine, 2-(1-methyl-1H-pyrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
