
CAS 1269294-19-0
:1-(2-Bromophenyl)-1H-pyrazole-5-carboxaldehyde
Description:
1-(2-Bromophenyl)-1H-pyrazole-5-carboxaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a bromophenyl group indicates that a bromine atom is substituted on the phenyl ring, contributing to the compound's reactivity and potential biological activity. The aldehyde functional group (-CHO) at the 5-position of the pyrazole ring is significant for its chemical reactivity, allowing for various reactions such as condensation and nucleophilic addition. This compound may exhibit interesting properties, including potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural features that can interact with biological targets. Additionally, the bromine substituent can enhance lipophilicity and influence the compound's solubility and permeability. Overall, 1-(2-Bromophenyl)-1H-pyrazole-5-carboxaldehyde is a versatile compound with potential utility in synthetic organic chemistry and drug discovery.
Formula:C10H7BrN2O
InChI:InChI=1S/C10H7BrN2O/c11-9-3-1-2-4-10(9)13-8(7-14)5-6-12-13/h1-7H
InChI key:InChIKey=QUCOOKYGFWBXFX-UHFFFAOYSA-N
SMILES:C(=O)C=1N(N=CC1)C2=C(Br)C=CC=C2
Synonyms:- 1H-Pyrazole-5-carboxaldehyde, 1-(2-bromophenyl)-
- 1-(2-Bromophenyl)-1H-pyrazole-5-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
