CAS 1269294-21-4
:1-(3-Chlorophenyl)-5-(2-thienyl)-1H-pyrazole
Description:
1-(3-Chlorophenyl)-5-(2-thienyl)-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a 3-chlorophenyl group and a 2-thienyl group. The presence of the chlorine atom on the phenyl ring enhances its lipophilicity and may influence its biological activity. The thienyl group contributes to the compound's aromatic character and can affect its electronic properties. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. Its molecular structure suggests potential for diverse reactivity and interactions, making it a subject of interest in research related to drug design and synthesis. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups, which are important considerations in both laboratory and industrial settings.
Formula:C13H9ClN2S
InChI:InChI=1S/C13H9ClN2S/c14-10-3-1-4-11(9-10)16-12(6-7-15-16)13-5-2-8-17-13/h1-9H
InChI key:InChIKey=GIPIFUSQEVHSQM-UHFFFAOYSA-N
SMILES:ClC=1C=C(N2C(=CC=N2)C3=CC=CS3)C=CC1
Synonyms:- 1H-Pyrazole, 1-(3-chlorophenyl)-5-(2-thienyl)-
- 1-(3-Chlorophenyl)-5-(2-thienyl)-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
