
CAS 1269294-22-5
:Pyridine, 2-[1-(4-fluorophenyl)-1H-pyrazol-5-yl]-
Description:
Pyridine, 2-[1-(4-fluorophenyl)-1H-pyrazol-5-yl]- is a chemical compound characterized by its heterocyclic structure, which includes a pyridine ring and a pyrazole moiety. The presence of the 4-fluorophenyl group introduces a fluorine atom, enhancing its electronic properties and potentially influencing its reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atom and the nitrogen atoms in the heterocycles, which can participate in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The compound may also exhibit specific solubility properties, depending on the solvent used, and could be sensitive to light or heat. As with many heterocyclic compounds, it may possess interesting biological activities, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H10FN3
InChI:InChI=1S/C14H10FN3/c15-11-4-6-12(7-5-11)18-14(8-10-17-18)13-3-1-2-9-16-13/h1-10H
InChI key:InChIKey=JQEQDNOMNJTRKQ-UHFFFAOYSA-N
SMILES:FC1=CC=C(N2C(=CC=N2)C3=CC=CC=N3)C=C1
Synonyms:- 2-(1-(4-Fluorophenyl)-1H-pyrazol-5-yl)pyridine
- Pyridine, 2-[1-(4-fluorophenyl)-1H-pyrazol-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
