CymitQuimica logo

CAS 1269294-23-6

:

3-[1-(4-Chlorophenyl)-1H-pyrazol-5-yl]pyridine

Description:
3-[1-(4-Chlorophenyl)-1H-pyrazol-5-yl]pyridine, identified by its CAS number 1269294-23-6, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrazole moiety substituted with a 4-chlorophenyl group. This compound typically exhibits properties associated with both heterocyclic compounds and aromatic systems, such as potential biological activity and solubility in organic solvents. The presence of the chlorophenyl group may enhance its lipophilicity and influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the pyrazole and pyridine rings can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its specific applications may vary, but compounds of this nature are often explored for their potential as pharmaceuticals or agrochemicals due to their diverse biological activities. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C14H10ClN3
InChI:InChI=1S/C14H10ClN3/c15-12-3-5-13(6-4-12)18-14(7-9-17-18)11-2-1-8-16-10-11/h1-10H
InChI key:InChIKey=VUFQTYKEZZUAMS-UHFFFAOYSA-N
SMILES:ClC1=CC=C(N2C(=CC=N2)C=3C=CC=NC3)C=C1
Synonyms:
  • 3-[1-(4-Chlorophenyl)-1H-pyrazol-5-yl]pyridine
  • Pyridine, 3-[1-(4-chlorophenyl)-1H-pyrazol-5-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.