CAS 1269294-33-8
:7,8-Difluoro-4-methyl-1(2H)-isoquinolinone
Description:
7,8-Difluoro-4-methyl-1(2H)-isoquinolinone is a synthetic organic compound characterized by its isoquinolinone structure, which features a fused bicyclic system. The presence of two fluorine atoms at the 7 and 8 positions contributes to its unique chemical properties, including increased lipophilicity and potential for enhanced biological activity. The methyl group at the 4 position further modifies its reactivity and solubility. This compound is typically used in medicinal chemistry and drug development due to its potential pharmacological applications. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in therapeutic contexts. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine atoms, which can affect its metabolic pathways and bioavailability. Overall, 7,8-Difluoro-4-methyl-1(2H)-isoquinolinone exemplifies the importance of structural modifications in the design of bioactive molecules.
Formula:C10H7F2NO
InChI:InChI=1S/C10H7F2NO/c1-5-4-13-10(14)8-6(5)2-3-7(11)9(8)12/h2-4H,1H3,(H,13,14)
InChI key:InChIKey=QBKPTVJYTLLGMX-UHFFFAOYSA-N
SMILES:FC1=C2C(C(C)=CNC2=O)=CC=C1F
Synonyms:- 1(2H)-Isoquinolinone, 7,8-difluoro-4-methyl-
- 7,8-Difluoro-4-methyl-1(2H)-isoquinolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
