
CAS 1269294-34-9
:1-(2-Fluorophenyl)-5-(2-thienyl)-1H-pyrazole
Description:
1-(2-Fluorophenyl)-5-(2-thienyl)-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a fluorophenyl group and a thienyl group. The presence of the fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. The thienyl group, derived from thiophene, contributes to the compound's aromatic character and may impart additional stability and reactivity due to the presence of sulfur. This compound is of interest in medicinal chemistry and material science, as its structural features may lead to interesting biological activities or applications in organic electronics. Its molecular interactions, solubility, and stability under various conditions are essential for understanding its potential uses. As with many pyrazole derivatives, it may exhibit a range of pharmacological properties, making it a candidate for further research in drug development or as a functional material.
Formula:C13H9FN2S
InChI:InChI=1S/C13H9FN2S/c14-10-4-1-2-5-11(10)16-12(7-8-15-16)13-6-3-9-17-13/h1-9H
InChI key:InChIKey=QFSUWRYMVHZNOH-UHFFFAOYSA-N
SMILES:FC1=C(N2C(=CC=N2)C3=CC=CS3)C=CC=C1
Synonyms:- 1H-Pyrazole, 1-(2-fluorophenyl)-5-(2-thienyl)-
- 1-(2-Fluorophenyl)-5-(2-thienyl)-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
