CAS 1269294-36-1
:3-(1-Phenyl-1H-pyrazol-5-yl)pyridine
Description:
3-(1-Phenyl-1H-pyrazol-5-yl)pyridine is an organic compound characterized by its unique structure, which features a pyridine ring substituted with a pyrazole moiety. The presence of the phenyl group on the pyrazole enhances its aromatic character and may influence its reactivity and interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in areas such as anti-inflammatory or anticancer research, although specific biological activities would depend on further empirical studies. The compound's stability, reactivity, and interaction with other molecules can be influenced by factors such as pH, temperature, and the presence of other functional groups. Overall, 3-(1-Phenyl-1H-pyrazol-5-yl)pyridine represents a class of compounds that may serve as valuable scaffolds in the design of novel pharmaceuticals.
Formula:C14H11N3
InChI:InChI=1S/C14H11N3/c1-2-6-13(7-3-1)17-14(8-10-16-17)12-5-4-9-15-11-12/h1-11H
InChI key:InChIKey=DUNWUHHRCWOPCU-UHFFFAOYSA-N
SMILES:C=1(N(N=CC1)C2=CC=CC=C2)C=3C=CC=NC3
Synonyms:- 3-(1-Phenyl-1H-pyrazol-5-yl)pyridine
- Pyridine, 3-(1-phenyl-1H-pyrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
