CAS 1269421-64-8

3,4-Dihydro-6-methyl-4-oxo-8-quinazolinecarboxylic acid

Description:

3,4-Dihydro-6-methyl-4-oxo-8-quinazolinecarboxylic acid is a chemical compound characterized by its quinazoline structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This substance features a carboxylic acid functional group, contributing to its acidic properties, and a ketone group, which can participate in various chemical reactions. The presence of a methyl group at the 6-position enhances its hydrophobic characteristics, potentially influencing its solubility and biological activity. The compound is typically studied for its potential pharmacological applications, particularly in medicinal chemistry, due to the biological significance of quinazoline derivatives. Its molecular structure allows for various interactions with biological targets, making it of interest in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 3,4-Dihydro-6-methyl-4-oxo-8-quinazolinecarboxylic acid represents a unique scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1S/C10H8N2O3/c1-5-2-6-8(7(3-5)10(14)15)11-4-12-9(6)13/h2-4H,1H3,(H,14,15)(H,11,12,13)

InChI key: InChIKey=NUPNSFDWUSHPCD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=CC(C)=C1)C(=O)N=CN2

Synonyms:

• 3,4-Dihydro-6-methyl-4-oxo-8-quinazolinecarboxylic acid
• 8-Quinazolinecarboxylic acid, 3,4-dihydro-6-methyl-4-oxo-